BIOPEP-UWM: Report
| ID | 11010 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 440.5340 | Monoisotopic mass | 440.2416 | |
| IC50 : | 474.62 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu R., Zhang H., Wu Y., Li H., Tang H., Xu X., Zhao K. | |
| Title | |
| Exploration and molecular mechanism of novel ACE inhibitory peptides from goat milk protein: A combined in silico and in vitro study. Int. Dairy J., 167, 106265, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C24H32N4O4/c25-14-8-7-13-20(27-22(29)19(26)15-17-9-3-1-4-10-17)23(30)28-21(24(31)32)16-18-11-5-2-6-12-18/h1-6,9-12,19-21H,7-8,13-16,25-26H2,(H,27,29)(H,28,30)(H,31,32)/t19-,20-,21-/m0/s1 InChIKey=KLXQWABNAWDRAY-ACRUOGEOSA-N Hypotensive peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| ChEBI: ID 161699 ChEMBL: ID CHEMBL1272234 ChemSpider: ID 26363338 Metabolomics Workbench: ID 84489 PubChem: CID 52943495 UniChem: ID 943383 Wikidata: ID Q106027809 ZINC: ID ZINC000034371363 |