BIOPEP-UWM: Report
| ID | 11012 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 484.5468 | Monoisotopic mass | 484.2427 | |
| IC50 : | 393.13 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu R., Zhang H., Wu Y., Li H., Tang H., Xu X., Zhao K. | |
| Title | |
| Exploration and molecular mechanism of novel ACE inhibitory peptides from goat milk protein: A combined in silico and in vitro study. Int. Dairy J., 167, 106265, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C24H32N6O5/c25-18(13-15-5-2-1-3-6-15)21(32)29-19(7-4-12-28-24(26)27)22(33)30-20(23(34)35)14-16-8-10-17(31)11-9-16/h1-3,5-6,8-11,18-20,31H,4,7,12-14,25H2,(H,29,32)(H,30,33)(H,34,35)(H4,26,27,28)/t18-,19-,20-/m0/s1 InChIKey=IWRZUGHCHFZYQZ-UFYCRDLUSA-N Hypotensive peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| BRENDA: Ligand Phe-Arg-Tyr ChEBI: ID 161312 ChemSpider: ID 26363338 Metabolomics Workbench: ID 84294 PubChem: CID 129827425 UniChem: ID 161191016 Wikidata: ID Q106015593 |