BIOPEP-UWM: Report
| ID | 11015 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 429.5114 | Monoisotopic mass | 429.2369 | |
| IC50 : | 562.67 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu R., Zhang H., Wu Y., Li H., Tang H., Xu X., Zhao K. | |
| Title | |
| Exploration and molecular mechanism of novel ACE inhibitory peptides from goat milk protein: A combined in silico and in vitro study. Int. Dairy J., 167, 106265, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C22H31N5O4/c23-10-4-3-8-18(21(29)27-11-5-9-19(27)22(30)31)26-20(28)16(24)12-14-13-25-17-7-2-1-6-15(14)17/h1-2,6-7,13,16,18-19,25H,3-5,8-12,23-24H2,(H,26,28)(H,30,31)/t16-,18-,19-/m0/s1 InChIKey=VDUJEEQMRQCLHB-WDSOQIARSA-N |
| Database reference: |