BIOPEP-UWM: Report
| ID | 11018 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Antiviral | |||
| Number of residues | 3 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 449.5457 | Monoisotopic mass | 449.2743 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Bonnard V., Pascale L., Azoulay S., Di Giorgio A.,Rogez-Kreuz C., Storck K., Pascal Clayette P., Patino N. | |
| Title | |
| Polyamide amino acids trimers as TAR RNA ligands and anti-HIV agents. Bioorg. Med. Chem., 18, 7432–7438, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C21H35N7O4/c22-11-5-4-9-16(27-18(29)15(23)13-14-7-2-1-3-8-14)19(30)28-17(20(31)32)10-6-12-26-21(24)25/h1-3,7-8,15-17H,4-6,9-13,22-23H2,(H,27,29)(H,28,30)(H,31,32)(H4,24,25,26)/t15-,16-,17-/m0/s1 InChIKey=DMEYUTSDVRCWRS-ULQDDVLXSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9211), the DFBP database, the EROP-MOSCOW database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9211 ChEBI: ID 161674 ChEMBL: ID CHEMBL1271468 ChemSpider: ID 26363276 DFBP: ID DFBPACEI1087 EROP-Moscow: ID E24933 Metabolomics Workbench: ID 84477 PubChem: CID 52943303 UniChem: ID 959675 Wikidata: ID Q106027804 ZINC: ID ZINC000039809575 |