BIOPEP-UWM: Report
| ID | 11021 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Antiviral | |||
| Number of residues | 3 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 468.5474 | Monoisotopic mass | 468.2478 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Bonnard V., Pascale L., Azoulay S., Di Giorgio A.,Rogez-Kreuz C., Storck K., Pascal Clayette P., Patino N. | |
| Title | |
| Polyamide amino acids trimers as TAR RNA ligands and anti-HIV agents. Bioorg. Med. Chem., 18, 7432–7438, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C24H32N6O4/c25-18(12-7-13-28-24(26)27)21(31)29-19(14-16-8-3-1-4-9-16)22(32)30-20(23(33)34)15-17-10-5-2-6-11-17/h1-6,8-11,18-20H,7,12-15,25H2,(H,29,31)(H,30,32)(H,33,34)(H4,26,27,28)/t18-,19-,20-/m0/s1 InChIKey=MNBHKGYCLBUIBC-UFYCRDLUSA-N |
| Database reference: |
| BindingDB: ID 50482593 BRENDA: Ligand Arg-Phe-Phe CAS: Registry No 58200-59-2 ChEBI: ID 159225 ChemSpider: ID 9549694 EPA CompTox: ID DTXSID20463951 Metabolomics Workbench: ID 79729 PubChem: CID 11374777 SureChEMBL: ID SCHEMBL10940118 UniChem: ID 650729 Wikidata: ID Q82289064 |