BIOPEP-UWM: Report
| ID | 11026 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 904.9639 | Monoisotopic mass | 904.4389 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen F., Liu H., Yan J., Shi Q., Yang H., Cao S., Qi X. | |
| Title | |
| Identification and molecular mechanism of novel antioxidant peptides from squid skin protein hydrolysates: In silico and in vitro analysis. LWT, 214, 117081, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C39H60N12O13/c1-20(2)14-24(48-35(60)25(16-29(41)53)49-36(61)26(17-31(55)56)46-30(54)18-45-32(57)22(40)19-52)34(59)47-23(10-6-12-44-39(42)43)33(58)50-27(15-21-8-4-3-5-9-21)37(62)51-13-7-11-28(51)38(63)64/h3-5,8-9,20,22-28,52H,6-7,10-19,40H2,1-2H3,(H2,41,53)(H,45,57)(H,46,54)(H,47,59)(H,48,60)(H,49,61)(H,50,58)(H,55,56)(H,63,64)(H4,42,43,44)/t22-,23-,24-,25-,26-,27-,28-/m0/s1 InChIKey=UPLXKKMCJHKENA-RMIXPHLWSA-N |
| Database reference: |