BIOPEP-UWM: Report
| ID | 11027 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 858.8528 | Monoisotopic mass | 858.3609 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen F., Liu H., Yan J., Shi Q., Yang H., Cao S., Qi X. | |
| Title | |
| Identification and molecular mechanism of novel antioxidant peptides from squid skin protein hydrolysates: In silico and in vitro analysis. LWT, 214, 117081, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C36H50N12O13/c1-18(31(55)48-25(36(60)61)12-20-14-40-17-43-20)44-28(51)15-41-33(57)22(8-10-27(39)50)46-35(59)23(11-19-5-3-2-4-6-19)45-29(52)16-42-34(58)24(13-30(53)54)47-32(56)21(37)7-9-26(38)49/h2-6,14,17-18,21-25H,7-13,15-16,37H2,1H3,(H2,38,49)(H2,39,50)(H,40,43)(H,41,57)(H,42,58)(H,44,51)(H,45,52)(H,46,59)(H,47,56)(H,48,55)(H,53,54)(H,60,61)/t18-,21-,22-,23-,24-,25-/m0/s1 InChIKey=LJYCLXRMLQMKMU-LHOYKQQOSA-N |
| Database reference: |