BIOPEP-UWM: Report
| ID | 11028 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 544.5986 | Monoisotopic mass | 544.2637 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lv L., Lv Q., Yang Y., Xiong F., Pei S., He S., Li B., Wu L., Cao Z., Li S., Yang H. | |
| Title | |
| Identification of novel antioxidant peptides from cottonseed meal co-fermented with Lactobacillus mucosae LLK-XR1 and acid proteases: In silico screening, molecular simulation, and in vitro functional analysis. Food Chem., 483, 144285, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C26H36N6O7/c1-16(23(35)29-15-22(34)31-11-6-10-20(31)26(38)39)30-21(33)14-28-24(36)19-9-5-12-32(19)25(37)18(27)13-17-7-3-2-4-8-17/h2-4,7-8,16,18-20H,5-6,9-15,27H2,1H3,(H,28,36)(H,29,35)(H,30,33)(H,38,39)/t16-,18-,19-,20-/m0/s1 InChIKey=LNBKYYSPFAKUQP-LEAZDLGRSA-N |
| Database reference: |