BIOPEP-UWM: Report
| ID | 11030 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 737.7611 | Monoisotopic mass | 737.3236 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lv L., Lv Q., Yang Y., Xiong F., Pei S., He S., Li B., Wu L., Cao Z., Li S., Yang H. | |
| Title | |
| Identification of novel antioxidant peptides from cottonseed meal co-fermented with Lactobacillus mucosae LLK-XR1 and acid proteases: In silico screening, molecular simulation, and in vitro functional analysis. Food Chem., 483, 144285, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)NCC(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C33H43N11O9/c34-22(16-45)29(48)41-24(10-20-12-35-17-39-20)30(49)38-14-27(46)37-15-28(47)44-8-4-7-26(44)32(51)42-23(9-19-5-2-1-3-6-19)31(50)43-25(33(52)53)11-21-13-36-18-40-21/h1-3,5-6,12-13,17-18,22-26,45H,4,7-11,14-16,34H2,(H,35,39)(H,36,40)(H,37,46)(H,38,49)(H,41,48)(H,42,51)(H,43,50)(H,52,53)/t22-,23-,24-,25-,26-/m0/s1 InChIKey=MTASXVRLLHYBOD-LROMGURASA-N |
| Database reference: |