BIOPEP-UWM: Report
| ID | 11031 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 581.6155 | Monoisotopic mass | 581.2477 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lv L., Lv Q., Yang Y., Xiong F., Pei S., He S., Li B., Wu L., Cao Z., Li S., Yang H. | |
| Title | |
| Identification of novel antioxidant peptides from cottonseed meal co-fermented with Lactobacillus mucosae LLK-XR1 and acid proteases: In silico screening, molecular simulation, and in vitro functional analysis. Food Chem., 483, 144285, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C29H35N5O8/c30-20(16-25(36)37)26(38)33-21(14-18-8-3-1-4-9-18)28(40)34-13-7-12-23(34)27(39)31-17-24(35)32-22(29(41)42)15-19-10-5-2-6-11-19/h1-6,8-11,20-23H,7,12-17,30H2,(H,31,39)(H,32,35)(H,33,38)(H,36,37)(H,41,42)/t20-,21-,22-,23-/m0/s1 InChIKey=DFNLTQPSNGRPEP-MLCQCVOFSA-N |
| Database reference: |