BIOPEP-UWM: Report
| ID | 11032 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 779.7977 | Monoisotopic mass | 779.3341 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lv L., Lv Q., Yang Y., Xiong F., Pei S., He S., Li B., Wu L., Cao Z., Li S., Yang H. | |
| Title | |
| Identification of novel antioxidant peptides from cottonseed meal co-fermented with Lactobacillus mucosae LLK-XR1 and acid proteases: In silico screening, molecular simulation, and in vitro functional analysis. Food Chem., 483, 144285, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)NCC(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C35H45N11O10/c36-23(8-9-30(49)50)31(51)43-25(12-21-14-37-18-41-21)32(52)40-16-28(47)39-17-29(48)46-10-4-7-27(46)34(54)44-24(11-20-5-2-1-3-6-20)33(53)45-26(35(55)56)13-22-15-38-19-42-22/h1-3,5-6,14-15,18-19,23-27H,4,7-13,16-17,36H2,(H,37,41)(H,38,42)(H,39,47)(H,40,52)(H,43,51)(H,44,54)(H,45,53)(H,49,50)(H,55,56)/t23-,24-,25-,26-,27-/m0/s1 InChIKey=UZBCAHQYYBWSJI-IRGGMKSGSA-N |
| Database reference: |