BIOPEP-UWM: Report
| ID | 11035 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 561.6703 | Monoisotopic mass | 561.2942 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shu Z., Wang G., Jing Y., Jiao C., Sun L., Huang H., Li Y., Zhang J. | |
| Title | |
| Enhancement of Apostichopus japonicus peptide flavor through bacterial and enzyme co-fermentation (BECF) and the identification of novel antioxidant peptides in the fermented product. Food Chem. X, 27, 102323, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C31H39N5O5/c1-19(2)15-23(32)28(37)34-25(16-20-9-4-3-5-10-20)30(39)36-14-8-13-27(36)29(38)35-26(31(40)41)17-21-18-33-24-12-7-6-11-22(21)24/h3-7,9-12,18-19,23,25-27,33H,8,13-17,32H2,1-2H3,(H,34,37)(H,35,38)(H,40,41)/t23-,25-,26-,27-/m0/s1 InChIKey=JHFUZKXBNQUARR-MNUOIFNESA-N |
| Database reference: |