BIOPEP-UWM: Report
| ID | 11036 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 464.5554 | Monoisotopic mass | 464.2416 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shu Z., Wang G., Jing Y., Jiao C., Sun L., Huang H., Li Y., Zhang J. | |
| Title | |
| Enhancement of Apostichopus japonicus peptide flavor through bacterial and enzyme co-fermentation (BECF) and the identification of novel antioxidant peptides in the fermented product. Food Chem. X, 27, 102323, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C26H32N4O4/c1-3-16(2)23(30-24(31)20(27)13-17-9-5-4-6-10-17)25(32)29-22(26(33)34)14-18-15-28-21-12-8-7-11-19(18)21/h4-12,15-16,20,22-23,28H,3,13-14,27H2,1-2H3,(H,29,32)(H,30,31)(H,33,34)/t16-,20-,22-,23-/m0/s1 InChIKey=NRKNYPRRWXVELC-NQCBNZPSSA-N |
| Database reference: |
| ChEBI: ID 161625 Metabolomics Workbench: ID 84453 PubChem: CID 145457249 UniChem: ID 176705763 Wikidata: ID Q106015995 |