BIOPEP-UWM: Report
| ID | 11043 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 471.5463 | Monoisotopic mass | 471.2684 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C21H37N5O7/c1-11(2)8-13(22)18(29)24-14(10-27)20(31)26-7-5-6-15(26)19(30)23-9-16(28)25-17(12(3)4)21(32)33/h11-15,17,27H,5-10,22H2,1-4H3,(H,23,30)(H,24,29)(H,25,28)(H,32,33)/t13-5-,17-/m0/s1 InChIKey=TYGYYGLAOBALJW-AGOFZYAISA-N Inhibitor of acetylcholinestrase (EC 3.1.1.7) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |