BIOPEP-UWM: Report
| ID | 11046 |
| Name | Acetylcholinesterase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of acetylcholinestrase (EC 3.1.1.7) | |||
| Number of residues | 12 |
Activity code | ache |
| Activity : | AChE inhibitor |
|||
| Chemical mass | 1395.8089 | Monoisotopic mass | 1394.9236 | |
| IC50 : | 34.09 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C71H122N14O14/c1-38(2)29-48(75-62(89)49(30-39(3)4)77-65(92)53(34-43(11)12)81-69(96)59(45(15)16)84-60(87)47(73)25-20-21-27-72)61(88)76-50(31-40(5)6)63(90)79-54(37-58(74)86)67(94)82-55(36-46-23-18-17-19-24-46)70(97)85-28-22-26-57(85)68(95)80-52(33-42(9)10)64(91)78-51(32-41(7)8)66(93)83-56(71(98)99)35-44(13)14/h17-19,23-24,38-45,47-57,59H,20-22,25-37,72-73H2,1-16H3,(H2,74,86)(H,75,89)(H,76,88)(H,77,92)(H,78,91)(H,79,90)(H,80,95)(H,81,96)(H,82,94)(H,83,93)(H,84,87)(H,98,99)/t47-,48-,49-,50-,51-,52-,53-,54-,55-,56-,57-,59-/m0/s1 InChIKey=HYUZZGXAXJWKOX-YWKAJPCVSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |