BIOPEP-UWM: Report
| ID | 11047 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 658.7406 | Monoisotopic mass | 658.3315 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C32H46N6O9/c1-18(2)26(31(45)38-16-8-12-24(38)32(46)47)36-27(41)19(3)34-29(43)23-11-7-15-37(23)30(44)22(13-14-25(39)40)35-28(42)21(33)17-20-9-5-4-6-10-20/h4-6,9-10,18-19,21-24,26H,7-8,11-17,33H2,1-3H3,(H,34,43)(H,35,42)(H,36,41)(H,39,40)(H,46,47)/t19-,21-,22-,23-,24-,26-/m0/s1 InChIKey=AFJHIYRRIRZDRZ-PSEZLDIXSA-N |
| Database reference: |