BIOPEP-UWM: Report
| ID | 11049 |
| Name | Acetylcholinesterase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of acetylcholinestrase (EC 3.1.1.7) | |||
| Number of residues | 4 |
Activity code | ache |
| Activity : | AChE inhibitor |
|||
| Chemical mass | 535.5902 | Monoisotopic mass | 535.2423 | |
| IC50 : | 35.92 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C28H33N5O6/c29-20(13-17-7-2-1-3-8-17)25(35)32-23(16-34)26(36)31-22(27(37)33-12-6-11-24(33)28(38)39)14-18-15-30-21-10-5-4-9-19(18)21/h1-5,7-10,15,20,22-24,30,34H,6,11-14,16,29H2,(H,31,36)(H,32,35)(H,38,39)/t20-,22-,23-,24-/m0/s1 InChIKey=CSMFIOOYXKRJSB-BIHRQFPBSA-N Inhibitor of acetylcholinestrase (EC 3.1.1.7) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |