BIOPEP-UWM: Report
| ID | 11050 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 657.7129 | Monoisotopic mass | 657.3112 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C31H43N7O9/c1-16(2)12-22(30(45)38-11-5-8-24(38)29(44)37-23(31(46)47)14-25(33)39)36-28(43)21(35-27(42)19(32)9-10-26(40)41)13-17-15-34-20-7-4-3-6-18(17)20/h3-4,6-7,15-16,19,21-24,34H,5,8-14,32H2,1-2H3,(H2,33,39)(H,35,42)(H,36,43)(H,37,44)(H,40,41)(H,46,47)/t19-,21-,22-,23-,24-/m0/s1 InChIKey=QOMJFPVFWMEKBA-DUSBTPNUSA-N |
| Database reference: |