BIOPEP-UWM: Report
| ID | 11052 |
| Name | Acetylcholinesterase inhibitor |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ache |
| Activity : | AChE inhibitor |
|||
| Chemical mass | 628.6751 | Monoisotopic mass | 628.2960 | |
| IC50 : | 22.29 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C29H40N8O8/c1-15(25(40)35-20(29(44)45)9-11-24(32)39)34-27(42)22-7-4-12-37(22)28(43)21(36-26(41)18(30)8-10-23(31)38)13-16-14-33-19-6-3-2-5-17(16)19/h2-3,5-6,14-15,18,20-22,33H,4,7-13,30H2,1H3,(H2,31,38)(H2,32,39)(H,34,42)(H,35,40)(H,36,41)(H,44,45)/t15-,18-,20-,21-,22-/m0/s1 InChIKey=MVVPGQZIGPOUSU-NHWIGJJZSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |