BIOPEP-UWM: Report
| ID | 11054 |
| Name | Acetylcholinesterase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of acetylcholinestrase (EC 3.1.1.7) | |||
| Number of residues | 5 |
Activity code | ache |
| Activity : | AChE inhibitor |
|||
| Chemical mass | 577.6680 | Monoisotopic mass | 577.3101 | |
| IC50 : | 288.10 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C28H43N5O8/c1-14(2)21(25(37)31-22(15(3)4)27(39)33-12-6-7-20(33)28(40)41)30-26(38)23(16(5)34)32-24(36)19(29)13-17-8-10-18(35)11-9-17/h8-11,14-16,19-23,34-35H,6-7,12-13,29H2,1-5H3,(H,30,38)(H,31,37)(H,32,36)(H,40,41)/t16-,19+,20+,21+,22+,23+/m1/s1 InChIKey=UPUKMDXTTUFOMV-KGJIALSRSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |