BIOPEP-UWM: Report
| ID | 11056 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 626.8292 | Monoisotopic mass | 626.4466 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C30H58N8O6/c1-16(2)12-20(31)25(39)36-22(13-17(3)4)28(42)37-23(14-18(5)6)27(41)35-21(10-9-11-34-30(32)33)26(40)38-24(29(43)44)15-19(7)8/h16-24H,9-15,31H2,1-8H3,(H,35,41)(H,36,39)(H,37,42)(H,38,40)(H,43,44)(H4,32,33,34)/t20-,21-,22-,23-,24-/m0/s1 InChIKey=CPYOCPKVCWTPHQ-LSBAASHUSA-N |
| Database reference: |