BIOPEP-UWM: Report
| ID | 11058 |
| Name | Acetylcholinesterase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of acetylcholinestrase (EC 3.1.1.7) | |||
| Number of residues | 7 |
Activity code | ache |
| Activity : | AChE inhibitor |
|||
| Chemical mass | 811.1037 | Monoisotopic mass | 810.5924 | |
| IC50 : | 42.80 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Gao S., Zhang X., Cao Z., Guo Y., Zhao R., Li L., Liu Y., Qin Q., Yi B., Zhao G. | |
| Title | |
| Efficient screening of synergistic antioxidant and AChE inhibitory peptides from sea cucumber (Stichopus japonicus) using a novel approach combining de novo sequencing and parallel peptide synthesis. Peptide Sci., 117, e70002, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C41H78N8O8/c1-22(2)17-29(37(52)46-31(19-24(5)6)39(54)48-33(41(56)57)21-26(9)10)44-36(51)30(18-23(3)4)45-38(53)32(20-25(7)8)47-40(55)34(27(11)12)49-35(50)28(43)15-13-14-16-42/h22-34H,13-21,42-43H2,1-12H3,(H,44,51)(H,45,53)(H,46,52)(H,47,55)(H,48,54)(H,49,50)(H,56,57)/t28-,29-,30-,31-,32-,33-,34-/m0/s1 InChIKey=PYMHEWGPEQLAJL-NXBWRCJVSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |