BIOPEP-UWM: Report
| ID | 11059 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 757.9159 | Monoisotopic mass | 757.4150 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao C., Li F., Yan S., Zhu L., Ma S., Zhang T., Zhang N., Fang H., Du G. | |
| Title | |
| Identification and activity assay in vivo and in vitro of novel antioxidant and anti-aging peptides from C-phycocyanin of Limnospira platensis. Algal Res., 89, 104042, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C41H55N7O7/c1-24(2)20-32(41(54)55)45-38(51)35(25(3)4)46-36(49)31(22-27-23-43-30-15-9-8-14-28(27)30)44-37(50)33-16-10-18-47(33)40(53)34-17-11-19-48(34)39(52)29(42)21-26-12-6-5-7-13-26/h5-9,12-15,23-25,29,31-35,43H,10-11,16-22,42H2,1-4H3,(H,44,50)(H,45,51)(H,46,49)(H,54,55)/t29-,31-,32-,33-,34-,35-/m0/s1 InChIKey=PRXYRCPUQRYNBP-LXOXETEGSA-N |
| Database reference: |