BIOPEP-UWM: Report
| ID | 11060 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 692.8015 | Monoisotopic mass | 692.3312 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao C., Li F., Yan S., Zhu L., Ma S., Zhang T., Zhang N., Fang H., Du G. | |
| Title | |
| Identification and activity assay in vivo and in vitro of novel antioxidant and anti-aging peptides from C-phycocyanin of Limnospira platensis. Algal Res., 89, 104042, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C39H44N6O6/c40-29(21-25-11-3-1-4-12-25)37(48)45-20-10-18-34(45)38(49)44-19-9-17-33(44)36(47)42-31(23-27-24-41-30-16-8-7-15-28(27)30)35(46)43-32(39(50)51)22-26-13-5-2-6-14-26/h1-8,11-16,24,29,31-34,41H,9-10,17-23,40H2,(H,42,47)(H,43,46)(H,50,51)/t29-,31-,32-,33-,34-/m0/s1 InChIKey=QTSWIIIHIWTQNE-JUZBSFEJSA-N |
| Database reference: |