BIOPEP-UWM: Report
ID | 11061 |
Name | Antioxidative peptide |
sequence |
Function: | |||
Antioxidative | |||
Number of residues | 12 |
Activity code | ao |
Activity : | antioxidative |
|||
Chemical mass | 1114.2941 | Monoisotopic mass | 1113.6276 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Zu X., Guo L., Zhou Z., Xiong G., Peng L., Liu Q., Fu J., Wang Y., Guo P., Li H. | |
Title | |
Antioxidant and anti-blackening dual-function silver carp scale peptides: in vitro studies and molecular mechanism. LWT, 224, 117857, 2025 | |
Year | Source |
2025 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C51H83N15O13/c1-5-30(4)42(61-46(74)36-16-8-20-63(36)40(69)27-56-43(71)33-13-9-22-65(33)48(76)32(24-29(2)3)59-38(67)25-52)47(75)58-28-41(70)64-21-11-17-37(64)49(77)66-23-10-14-34(66)44(72)57-26-39(68)62-19-7-15-35(62)45(73)60-31(50(78)79)12-6-18-55-51(53)54/h29-37,42H,5-28,52H2,1-4H3,(H,56,71)(H,57,72)(H,58,75)(H,59,67)(H,60,73)(H,61,74)(H,78,79)(H4,53,54,55)/t30-,31-,32-,33-,34-,35-,36-,37-,42-/m0/s1 InChIKey=AZDPVOIGYGCGHE-HFRCKLQCSA-N |
Database reference: |