BIOPEP-UWM: Report
| ID | 11063 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 13 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1201.3712 | Monoisotopic mass | 1200.6595 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zu X., Guo L., Zhou Z., Xiong G., Peng L., Liu Q., Fu J., Wang Y., Guo P., Li H. | |
| Title | |
| Antioxidant and anti-blackening dual-function silver carp scale peptides: in vitro studies and molecular mechanism. LWT, 224, 117857, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C54H88N16O15/c1-5-31(4)44(65-49(80)38-16-8-20-67(38)42(74)27-60-46(77)35-13-9-22-69(35)51(82)34(24-30(2)3)63-40(72)25-59-45(76)32(55)29-71)50(81)62-28-43(75)68-21-11-17-39(68)52(83)70-23-10-14-36(70)47(78)61-26-41(73)66-19-7-15-37(66)48(79)64-33(53(84)85)12-6-18-58-54(56)57/h30-39,44,71H,5-29,55H2,1-4H3,(H,59,76)(H,60,77)(H,61,78)(H,62,81)(H,63,72)(H,64,79)(H,65,80)(H,84,85)(H4,56,57,58)/t31-,32-,33-,34-,35-,36-,37-,38-,39-,44-/m0/s1 InChIKey=WALYGROJWAJMPT-YRUGJKAHSA-N |
| Database reference: |