BIOPEP-UWM: Report
| ID | 11089 |
| Name | Nickel binding peptide |
| sequence |
| Function: | |||
| Nickel binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 854.8641 | Monoisotopic mass | 854.3660 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| EchavarrÃa J. A. C., Mathé C., Girardet J.-M., Paris C., Udenigwe C. C., Selmeczi K., Canabady-Rochelle L. | |
| Title | |
| Identification of Ni2+-binding peptides in sunflower meal protein hydrolysate for deeper understanding of peptide-metal interactions. J. Inorg. Biochem., 269, 112877, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C37H50N12O12/c1-17(2)7-23(46-32(55)21(38)8-18-13-42-22-6-4-3-5-20(18)22)34(57)47-24(9-19-14-41-16-44-19)35(58)48-25(10-28(39)50)36(59)49-26(12-31(53)54)33(56)43-15-30(52)45-27(37(60)61)11-29(40)51/h3-6,13-14,16-17,21,23-27,42H,7-12,15,38H2,1-2H3,(H2,39,50)(H2,40,51)(H,41,44)(H,43,56)(H,45,52)(H,46,55)(H,47,57)(H,48,58)(H,49,59)(H,53,54)(H,60,61)/t21-,23-,24-,25-,26-,27-/m0/s1 InChIKey=LKPROEZYAWFCAG-BLECARSGSA-N |
| Database reference: |