BIOPEP-UWM: Report
| ID | 11090 |
| Name | Nickel binding peptide |
| sequence |
| Function: | |||
| Nickel binding | |||
| Number of residues | 9 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1085.0814 | Monoisotopic mass | 1084.4559 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| EchavarrÃa J. A. C., Mathé C., Girardet J.-M., Paris C., Udenigwe C. C., Selmeczi K., Canabady-Rochelle L. | |
| Title | |
| Identification of Ni2+-binding peptides in sunflower meal protein hydrolysate for deeper understanding of peptide-metal interactions. J. Inorg. Biochem., 269, 112877, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C46H64N14O17/c1-20(2)10-28(56-39(69)25(47)11-22-16-51-26-7-5-4-6-24(22)26)41(71)57-29(12-23-17-50-19-53-23)42(72)58-31(14-34(49)63)43(73)59-32(15-37(67)68)40(70)52-18-35(64)54-30(13-33(48)62)44(74)60-38(21(3)61)45(75)55-27(46(76)77)8-9-36(65)66/h4-7,16-17,19-21,25,27-32,38,51,61H,8-15,18,47H2,1-3H3,(H2,48,62)(H2,49,63)(H,50,53)(H,52,70)(H,54,64)(H,55,75)(H,56,69)(H,57,71)(H,58,72)(H,59,73)(H,60,74)(H,65,66)(H,67,68)(H,76,77)/t21-,25+,27+,28+,29+,30+,31+,32+,38+/m1/s1 InChIKey=IQBUXSNTZBAIGT-YZMMXZLHSA-N |
| Database reference: |