BIOPEP-UWM: Report
| ID | 11092 |
| Name | Nickel binding peptide |
| sequence |
| Function: | |||
| Nickel binding | |||
| Number of residues | 8 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 766.8401 | Monoisotopic mass | 766.3961 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| EchavarrÃa J. A. C., Mathé C., Girardet J.-M., Paris C., Udenigwe C. C., Selmeczi K., Canabady-Rochelle L. | |
| Title | |
| Identification of Ni2+-binding peptides in sunflower meal protein hydrolysate for deeper understanding of peptide-metal interactions. J. Inorg. Biochem., 269, 112877, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C33H54N10O11/c1-7-15(2)24(41-27(47)16(3)34)32(52)43-10-8-9-22(43)29(49)42-25(18(5)44)30(50)36-13-23(46)40-26(19(6)45)31(51)38-17(4)28(48)39-21(33(53)54)11-20-12-35-14-37-20/h12,14-19,21-22,24-26,44-45H,7-11,13,34H2,1-6H3,(H,35,37)(H,36,50)(H,38,51)(H,39,48)(H,40,46)(H,41,47)(H,42,49)(H,53,54)/t15-,16-,17-,18+,19+,21-,22-,24-,25-,26-/m0/s1 InChIKey=DEOMEZPKDGOKQA-WMQJGJINSA-N |
| Database reference: |