BIOPEP-UWM: Report
| ID | 11093 |
| Name | Nickel binding peptide |
| sequence |
| Function: | |||
| Nickel binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 883.0425 | Monoisotopic mass | 882.4948 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| EchavarrÃa J. A. C., Mathé C., Girardet J.-M., Paris C., Udenigwe C. C., Selmeczi K., Canabady-Rochelle L. | |
| Title | |
| Identification of Ni2+-binding peptides in sunflower meal protein hydrolysate for deeper understanding of peptide-metal interactions. J. Inorg. Biochem., 269, 112877, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C43H66N10O10/c1-5-26(4)36(52-40(59)34-15-11-19-53(34)42(61)32(21-27-12-7-6-8-13-27)50-37(56)29(45)14-9-10-18-44)41(60)49-31(20-25(2)3)39(58)48-30(16-17-35(54)55)38(57)51-33(43(62)63)22-28-23-46-24-47-28/h6-8,12-13,23-26,29-34,36H,5,9-11,14-22,44-45H2,1-4H3,(H,46,47)(H,48,58)(H,49,60)(H,50,56)(H,51,57)(H,52,59)(H,54,55)(H,62,63)/t26-,29-,30-,31-,32-,33-,34-,36-/m0/s1 InChIKey=TWRWRZOZZPMPTI-ZUNOFDKRSA-N |
| Database reference: |