BIOPEP-UWM: Report
| ID | 11094 |
| Name | Nickel binding peptide |
| sequence |
| Function: | |||
| Nickel binding | |||
| Number of residues | 9 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1152.3849 | Monoisotopic mass | 1151.6795 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| EchavarrÃa J. A. C., Mathé C., Girardet J.-M., Paris C., Udenigwe C. C., Selmeczi K., Canabady-Rochelle L. | |
| Title | |
| Identification of Ni2+-binding peptides in sunflower meal protein hydrolysate for deeper understanding of peptide-metal interactions. J. Inorg. Biochem., 269, 112877, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C55H89N15O12/c1-7-33(6)45(69-51(78)43-19-14-24-70(43)53(80)42(27-34-15-9-8-10-16-34)68-46(73)36(57)17-11-12-22-56)52(79)67-40(26-32(4)5)48(75)63-37(20-21-44(71)72)47(74)66-41(28-35-29-60-30-62-35)50(77)65-39(25-31(2)3)49(76)64-38(54(81)82)18-13-23-61-55(58)59/h8-10,15-16,29-33,36-43,45H,7,11-14,17-28,56-57H2,1-6H3,(H,60,62)(H,63,75)(H,64,76)(H,65,77)(H,66,74)(H,67,79)(H,68,73)(H,69,78)(H,71,72)(H,81,82)(H4,58,59,61)/t33-,36-,37-,38-,39-,40-,41-,42-,43-,45-/m0/s1 InChIKey=FOJJPEAPKSNTIK-YDDDSQBKSA-N |
| Database reference: |