BIOPEP-UWM: Report
| ID | 11095 |
| Name | Nickel binding peptide |
| sequence |
| Function: | |||
| Nickel binding | |||
| Number of residues | 8 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 996.1997 | Monoisotopic mass | 995.5786 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| EchavarrÃa J. A. C., Mathé C., Girardet J.-M., Paris C., Udenigwe C. C., Selmeczi K., Canabady-Rochelle L. | |
| Title | |
| Identification of Ni2+-binding peptides in sunflower meal protein hydrolysate for deeper understanding of peptide-metal interactions. J. Inorg. Biochem., 269, 112877, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C49H77N11O11/c1-7-30(6)41(59-46(67)39-17-13-21-60(39)48(69)37(24-31-14-9-8-10-15-31)57-42(63)33(51)16-11-12-20-50)47(68)56-35(22-28(2)3)44(65)54-34(18-19-40(61)62)43(64)55-36(25-32-26-52-27-53-32)45(66)58-38(49(70)71)23-29(4)5/h8-10,14-15,26-30,33-39,41H,7,11-13,16-25,50-51H2,1-6H3,(H,52,53)(H,54,65)(H,55,64)(H,56,68)(H,57,63)(H,58,66)(H,59,67)(H,61,62)(H,70,71)/t30-,33-,34-,35-,36-,37-,38-,39-,41-/m0/s1 InChIKey=RYAYXBJNKYOWAZ-XFIHANRVSA-N |
| Database reference: |