BIOPEP-UWM: Report
| ID | 11097 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 990.0631 | Monoisotopic mass | 989.5012 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C41H71N11O17/c1-9-18(6)30(50-33(60)21(42)10-13-27(58)59)38(65)46-23(14-26(44)57)35(62)51-32(20(8)55)40(67)49-28(16(2)3)36(63)45-22(11-12-25(43)56)34(61)48-29(17(4)5)37(64)52-31(19(7)54)39(66)47-24(15-53)41(68)69/h16-24,28-32,53-55H,9-15,42H2,1-8H3,(H2,43,56)(H2,44,57)(H,45,63)(H,46,65)(H,47,66)(H,48,61)(H,49,67)(H,50,60)(H,51,62)(H,52,64)(H,58,59)(H,68,69)/t18-,19+,20+,21-,22-,23-,24-,28-,29-,30-,31-,32-/m0/s1 InChIKey=BGHZMFMUFAAQIJ-OAGSXGICSA-N |
| Database reference: |