BIOPEP-UWM: Report
| ID | 11098 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 984.0586 | Monoisotopic mass | 983.4907 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C42H69N11O16/c1-6-20(4)32(50-34(60)23(12-14-30(58)59)46-36(62)26-9-7-15-52(26)41(67)27-10-8-16-53(27)40(66)22(43)18-54)38(64)48-25(17-29(45)57)35(61)51-33(21(5)55)39(65)49-31(19(2)3)37(63)47-24(42(68)69)11-13-28(44)56/h19-27,31-33,54-55H,6-18,43H2,1-5H3,(H2,44,56)(H2,45,57)(H,46,62)(H,47,63)(H,48,64)(H,49,65)(H,50,60)(H,51,61)(H,58,59)(H,68,69)/t20-,21+,22-,23-,24-,25-,26-,27-,31-,32-,33-/m0/s1 InChIKey=NCEALKXZWABSMG-VDAPREFFSA-N |
| Database reference: |