BIOPEP-UWM: Report
| ID | 11099 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1173.2703 | Monoisotopic mass | 1172.6017 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C49H84N14O19/c1-5-23(2)37(48(80)63-20-10-13-32(63)46(78)62-39(25(4)65)49(81)82)60-43(75)29(15-17-35(68)69)57-47(79)38(24(3)64)61-42(74)27(12-7-9-19-51)55-45(77)31(22-36(70)71)59-41(73)28(14-16-33(53)66)56-44(76)30(21-34(54)67)58-40(72)26(52)11-6-8-18-50/h23-32,37-39,64-65H,5-22,50-52H2,1-4H3,(H2,53,66)(H2,54,67)(H,55,77)(H,56,76)(H,57,79)(H,58,72)(H,59,73)(H,60,75)(H,61,74)(H,62,78)(H,68,69)(H,70,71)(H,81,82)/t23-,24+,25+,26-,27-,28-,29-,30-,31-,32-,37-,38-,39-/m0/s1 InChIKey=GMHUFFCSKYUGJW-BBUUEJHJSA-N |
| Database reference: |