BIOPEP-UWM: Report
| ID | 11104 |
| Name | Antidepressant-like peptide |
| sequence |
| Function: | |||
| Antidepressant-like activity | |||
| Number of residues | 2 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 268.3114 | Monoisotopic mass | 268.1531 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ano Y., Kita M., Kitaoka S., Furuyashiki T. | |
| Title | |
| Leucine-histidine dipeptide attenuates micxroglial activation and emotional disturbances induced by brain inflammation and repeated social defeat stress. Nutrients, 11, 2161, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC1=CN=CN1)C(O)=O InChI=1S/C12H20N4O3/c1-7(2)3-9(13)11(17)16-10(12(18)19)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/t9-,10-/m0/s1 InChIKey=XWOBNBRUDDUEEY-UWVGGRQHSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8820) Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3305); the DFBP database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 3305; 8820 ChEBI: ID 74539 ChEMBL: ID CHEMBL1229090 ChemSpider: ID 5360949 DFBP: ID DFBPANOX0034 EROP-Moscow: ID E09289 FooDB: ID FDB111958 HMDB: ID HMDB0028931 J-GLOBAL: ID 200907009190795710 Metabolomics Workbench: ID 78864 Nikkaji: ID J89.193B PubChem: CID 6992828 Wikidata: ID Q27144716 ZINC: ID ZINC000001589379 |