BIOPEP-UWM: Report
| ID | 11116 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 410.3777 | Monoisotopic mass | 410.1432 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang R., Danzeng Z., Yang J., Qu J., Zhu R., Li H., Tang H., Li C., Zhao K. | |
| Title | |
| Identification and exploration of the potential antiaging role of the novel antioxidant peptide DGGY derived from yak milk proteins. J. Dairy Sci., 108, 5543–5557, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C17H22N4O8/c18-11(6-15(25)26)16(27)20-7-13(23)19-8-14(24)21-12(17(28)29)5-9-1-3-10(22)4-2-9/h1-4,11-12,22H,5-8,18H2,(H,19,23)(H,20,27)(H,21,24)(H,25,26)(H,28,29)/t11-,12-/m0/s1 InChIKey=VOFULODFAKBEIV-RYUDHWBXSA-N |
| Database reference: |