BIOPEP-UWM: Report
| ID | 11117 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 674.7417 | Monoisotopic mass | 674.3054 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liang Q., Zhou W., Peng S., Liang Z., Liu Z., Wang L., Mukhtar H., Mou H. | |
| Title | |
| Exploration of ACE inhibitory peptides from sea cucumber viscera with DPP-IV inhibitory activity: Virtual screening, characterization, and potential mechanism investigation. Int. J. Biol. Macromol., 311, 143843, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C35H42N6O8/c36-24(19-22-20-37-25-11-5-4-10-23(22)25)31(44)38-26(14-15-30(42)43)33(46)40-16-6-12-28(40)32(45)39-27(18-21-8-2-1-3-9-21)34(47)41-17-7-13-29(41)35(48)49/h1-5,8-11,20,24,26-29,37H,6-7,12-19,36H2,(H,38,44)(H,39,45)(H,42,43)(H,48,49)/t24-,26-,27-,28-,29-/m0/s1 InChIKey=ORXXYKDSSIGFKN-CISYKLKFSA-N |
| Database reference: |