BIOPEP-UWM: Report
| ID | 11119 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 570.6358 | Monoisotopic mass | 570.2793 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liang Q., Zhou W., Peng S., Liang Z., Liu Z., Wang L., Mukhtar H., Mou H. | |
| Title | |
| Exploration of ACE inhibitory peptides from sea cucumber viscera with DPP-IV inhibitory activity: Virtual screening, characterization, and potential mechanism investigation. Int. J. Biol. Macromol., 311, 143843, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C28H38N6O7/c29-19(15-18-7-2-1-3-8-18)26(38)33-13-4-9-20(33)25(37)31-16-23(35)30-17-24(36)32-12-5-10-21(32)27(39)34-14-6-11-22(34)28(40)41/h1-3,7-8,19-22H,4-6,9-17,29H2,(H,30,35)(H,31,37)(H,40,41)/t19-,20-,21-,22-/m0/s1 InChIKey=RUCAYNPNUBYNAD-CMOCDZPBSA-N |
| Database reference: |