BIOPEP-UWM: Report
| ID | 11120 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 723.8567 | Monoisotopic mass | 723.3943 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liang Q., Zhou W., Peng S., Liang Z., Liu Z., Wang L., Mukhtar H., Mou H. | |
| Title | |
| Exploration of ACE inhibitory peptides from sea cucumber viscera with DPP-IV inhibitory activity: Virtual screening, characterization, and potential mechanism investigation. Int. J. Biol. Macromol., 311, 143843, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C37H53N7O8/c1-23(2)20-25(38)34(48)43-18-8-14-29(43)36(50)42-17-7-12-27(42)32(46)39-22-31(45)41-16-6-13-28(41)33(47)40-26(21-24-10-4-3-5-11-24)35(49)44-19-9-15-30(44)37(51)52/h3-5,10-11,23,25-30H,6-9,12-22,38H2,1-2H3,(H,39,46)(H,40,47)(H,51,52)/t25-,26-,27-,28-,29-,30-/m0/s1 InChIKey=GXWMIFVNDXISSE-WPMUBMLPSA-N |
| Database reference: |