BIOPEP-UWM: Report
| ID | 11122 |
| Name | Dipeptidyl peptidase IV (DPPIV) inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 586.6781 | Monoisotopic mass | 586.3105 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liang Q., Zhou W., Peng S., Liang Z., Liu Z., Wang L., Mukhtar H., Mou H. | |
| Title | |
| Exploration of ACE inhibitory peptides from sea cucumber viscera with DPP-IV inhibitory activity: Virtual screening, characterization, and potential mechanism investigation. Int. J. Biol. Macromol., 311, 143843, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C29H42N6O7/c1-18(2)14-20(27(39)35-13-7-11-23(35)29(41)42)33-25(37)17-31-26(38)22-10-6-12-34(22)28(40)21(32-24(36)16-30)15-19-8-4-3-5-9-19/h3-5,8-9,18,20-23H,6-7,10-17,30H2,1-2H3,(H,31,38)(H,32,36)(H,33,37)(H,41,42)/t20-,21-,22-,23-/m0/s1 InChIKey=SLGIQEPHAHGGJA-MLCQCVOFSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |