BIOPEP-UWM: Report
| ID | 11128 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 804.8847 | Monoisotopic mass | 804.4004 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O InChI=1S/C37H56N8O12/c1-19(2)16-26(33(53)40-18-30(50)51)43-36(56)31(20(3)4)44-35(55)27-6-5-15-45(27)37(57)25(12-14-29(48)49)42-34(54)24(11-13-28(39)47)41-32(52)23(38)17-21-7-9-22(46)10-8-21/h7-10,19-20,23-27,31,46H,5-6,11-18,38H2,1-4H3,(H2,39,47)(H,40,53)(H,41,52)(H,42,54)(H,43,56)(H,44,55)(H,48,49)(H,50,51)/t23-,24-,25-,26-,27-,31-/m0/s1 InChIKey=AOOZLDLQEPNKPW-GKDLNYNLSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |