BIOPEP-UWM: Report
| ID | 11130 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 855.9297 | Monoisotopic mass | 855.4323 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C37H61N9O14/c1-19(2)16-24(37(59)60)43-32(54)23(17-29(51)52)41-27(48)18-40-31(53)22(11-12-28(49)50)42-33(55)25-9-7-15-46(25)36(58)30(20(3)47)44-34(56)26-10-6-14-45(26)35(57)21(39)8-4-5-13-38/h19-26,30,47H,4-18,38-39H2,1-3H3,(H,40,53)(H,41,48)(H,42,55)(H,43,54)(H,44,56)(H,49,50)(H,51,52)(H,59,60)/t20-,21+,22+,23+,24+,25+,26+,30+/m1/s1 InChIKey=MRNRPXMJBKFBDU-ZSSHWEIESA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |