BIOPEP-UWM: Report
| ID | 11131 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 941.0818 | Monoisotopic mass | 940.5115 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C44H68N12O11/c1-5-24(2)35(54-38(60)29(46)14-9-10-18-45)42(64)53-32(21-28-22-48-23-49-28)43(65)56-19-11-15-33(56)41(63)52-31(20-27-12-7-6-8-13-27)40(62)50-25(3)37(59)51-30(16-17-34(47)58)39(61)55-36(26(4)57)44(66)67/h6-8,12-13,22-26,29-33,35-36,57H,5,9-11,14-21,45-46H2,1-4H3,(H2,47,58)(H,48,49)(H,50,62)(H,51,59)(H,52,63)(H,53,64)(H,54,60)(H,55,61)(H,66,67)/t24-,25-,26+,29-,30-,31-,32-,33-,35-,36-/m0/s1 InChIKey=ISBPGFKLZPNXQN-LNMUSMGDSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |