BIOPEP-UWM: Report
| ID | 11133 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1217.3673 | Monoisotopic mass | 1216.6431 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C55H88N14O17/c1-8-29(6)44(68-47(77)35(14-10-12-20-57)62-51(81)42(58)27(2)3)53(83)69-45(30(7)70)54(84)67-43(28(4)5)52(82)65-38(24-41(74)75)50(80)64-37(23-40(72)73)49(79)61-34(13-9-11-19-56)46(76)63-36(22-32-25-59-26-60-32)48(78)66-39(55(85)86)21-31-15-17-33(71)18-16-31/h15-18,25-30,34-39,42-45,70-71H,8-14,19-24,56-58H2,1-7H3,(H,59,60)(H,61,79)(H,62,81)(H,63,76)(H,64,80)(H,65,82)(H,66,78)(H,67,84)(H,68,77)(H,69,83)(H,72,73)(H,74,75)(H,85,86)/t29-,30+,34-,35-,36-,37-,38-,39-,42-,43-,44-,45-/m0/s1 InChIKey=BYTVGUDCXGVMTR-HJCRTZGGSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |