BIOPEP-UWM: Report
| ID | 11134 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1086.2362 | Monoisotopic mass | 1085.5528 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C54H75N11O13/c1-31(2)27-43(54(77)78)64-51(74)41(29-34-15-19-36(67)20-16-34)62-50(73)40(22-24-46(58)69)61-52(75)44-12-8-26-65(44)53(76)42(30-32-9-4-3-5-10-32)63-48(71)38(11-6-7-25-55)60-49(72)39(21-23-45(57)68)59-47(70)37(56)28-33-13-17-35(66)18-14-33/h3-5,9-10,13-20,31,37-44,66-67H,6-8,11-12,21-30,55-56H2,1-2H3,(H2,57,68)(H2,58,69)(H,59,70)(H,60,72)(H,61,75)(H,62,73)(H,63,71)(H,64,74)(H,77,78)/t37-,38-,39-,40-,41-,42-,43-,44-/m0/s1 InChIKey=PZGHGKXJGQDXDY-YTAGXALCSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |