BIOPEP-UWM: Report
| ID | 11137 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1081.2626 | Monoisotopic mass | 1080.6272 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C48H84N14O14/c1-10-24(6)35(43(71)60-37(27(9)64)46(74)62-19-13-16-32(62)42(70)59-36(26(8)63)44(72)56-30(47(75)76)20-22(2)3)58-41(69)31-15-12-18-61(31)45(73)34(23(4)5)57-38(66)25(7)54-40(68)29(21-33(50)65)55-39(67)28(49)14-11-17-53-48(51)52/h22-32,34-37,63-64H,10-21,49H2,1-9H3,(H2,50,65)(H,54,68)(H,55,67)(H,56,72)(H,57,66)(H,58,69)(H,59,70)(H,60,71)(H,75,76)(H4,51,52,53)/t24-,25-,26+,27+,28-,29-,30-,31-,32-,34-,35-,36-,37-/m0/s1 InChIKey=JOPISTVULUNBPD-DAVTWUSNSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |