BIOPEP-UWM: Report
| ID | 11140 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 9 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 926.0639 | Monoisotopic mass | 925.4893 | |
| IC50 : | 1.57 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C45H67N9O12/c1-25(2)23-31(50-40(60)32(24-27-11-6-5-7-12-27)51-42(62)34-15-9-21-53(34)43(63)29-13-8-20-47-29)39(59)49-30(16-18-35(46)55)44(64)54-22-10-14-33(54)41(61)48-28(17-19-36(56)57)38(58)52-37(26(3)4)45(65)66/h5-7,11-12,25-26,28-34,37,47H,8-10,13-24H2,1-4H3,(H2,46,55)(H,48,61)(H,49,59)(H,50,60)(H,51,62)(H,52,58)(H,56,57)(H,65,66)/t28-,29-,30-,31-,32-,33-,34-,37-/m0/s1 InChIKey=GAJFXZGNZSABJB-DCDHIVBYSA-N |
| Database reference: |