BIOPEP-UWM: Report
| ID | 11141 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 12 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1320.5709 | Monoisotopic mass | 1319.7465 | |
| IC50 : | 1.57 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C65H101N13O16/c1-34(2)32-43(56(84)69-42(24-26-48(66)79)62(90)76-29-15-21-45(76)58(86)68-41(25-27-49(80)81)55(83)75-53(38(9)10)65(93)94)70-57(85)44(33-39-18-12-11-13-19-39)71-59(87)46-22-16-30-77(46)63(91)47-23-17-31-78(47)64(92)52(37(7)8)74-61(89)51(36(5)6)73-60(88)50(35(3)4)72-54(82)40-20-14-28-67-40/h11-13,18-19,34-38,40-47,50-53,67H,14-17,20-33H2,1-10H3,(H2,66,79)(H,68,86)(H,69,84)(H,70,85)(H,71,87)(H,72,82)(H,73,88)(H,74,89)(H,75,83)(H,80,81)(H,93,94)/t40-,41-,42-,43-,44-,45-,46-,47-,50-,51-,52-,53-/m0/s1 InChIKey=BMGSLDQDEHYCCA-LMURHTALSA-N |
| Database reference: |