BIOPEP-UWM: Report
| ID | 11142 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 11 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1259.4468 | Monoisotopic mass | 1258.6899 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C58H94N14O17/c1-28(2)19-36(64-52(82)38(25-44(60)73)66-49(79)35(15-16-45(74)75)63-55(85)47(32(9)10)70-48(78)34(59)24-46(76)77)50(80)65-37(23-33-26-61-27-62-33)51(81)67-39(20-29(3)4)56(86)71-17-11-13-42(71)53(83)68-40(21-30(5)6)57(87)72-18-12-14-43(72)54(84)69-41(58(88)89)22-31(7)8/h26-32,34-43,47H,11-25,59H2,1-10H3,(H2,60,73)(H,61,62)(H,63,85)(H,64,82)(H,65,80)(H,66,79)(H,67,81)(H,68,83)(H,69,84)(H,70,78)(H,74,75)(H,76,77)(H,88,89)/t34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,47-/m0/s1 InChIKey=CQTUYSRLKPWJEZ-HAUAEBSWSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |